C16H12FNO2 — CID 825188
(3R)-3-benzyl-3-fluoro-1H-quinoline-2,4-dione (PubChem CID 825188) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is (3R)-3-benzyl-3-fluoro-1H-quinoline-2,4-dione.
| Compound Name | (3R)-3-benzyl-3-fluoro-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 825188 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (3R)-3-benzyl-3-fluoro-1H-quinoline-2,4-dione |
| SMILES | O=C1Nc2ccccc2C(=O)[C@]1(F)Cc1ccccc1 |
| InChI | InChI=1S/C16H12FNO2/c17-16(10-11-6-2-1-3-7-11)14(19)12-8-4-5-9-13(12)18-15(16)20/h1-9H,10H2,(H,18,20)/t16-/m1/s1 |
| InChIKey | LUFFBUJDPYJBIM-MRXNPFEDSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|