C14H16FNO3 — CID 101031126
4-(3-fluoro-2-oxo-1H-indol-3-yl)butyl acetate (PubChem CID 101031126) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is 4-(3-fluoro-2-oxo-1H-indol-3-yl)butyl acetate.
| Compound Name | 4-(3-fluoro-2-oxo-1H-indol-3-yl)butyl acetate |
|---|---|
| PubChem CID | 101031126 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(3-fluoro-2-oxo-1H-indol-3-yl)butyl acetate |
| SMILES | CC(=O)OCCCCC1(F)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H16FNO3/c1-10(17)19-9-5-4-8-14(15)11-6-2-3-7-12(11)16-13(14)18/h2-3,6-7H,4-5,8-9H2,1H3,(H,16,18) |
| InChIKey | LNDZSFIBCOVDAO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|