C21H20ClNO5 — CID 56837652
ethyl (2R)-2-acetyloxy-2-[(3R)-3-[(4-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]acetate (PubChem CID 56837652) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is ethyl (2R)-2-acetyloxy-2-[(3R)-3-[(4-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]acetate.
| Compound Name | ethyl (2R)-2-acetyloxy-2-[(3R)-3-[(4-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 56837652 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | ethyl (2R)-2-acetyloxy-2-[(3R)-3-[(4-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]acetate |
| SMILES | CCOC(=O)[C@H](OC(C)=O)[C@]1(Cc2ccc(Cl)cc2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C21H20ClNO5/c1-3-27-19(25)18(28-13(2)24)21(12-14-8-10-15(22)11-9-14)16-6-4-5-7-17(16)23-20(21)26/h4-11,18H,3,12H2,1-2H3,(H,23,26)/t18-,21+/m0/s1 |
| InChIKey | JVEWGFLRUYCNRQ-GHTZIAJQSA-N |
| XLogP | 3.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |