C18H27NO2 — CID 70402861
4,4-dipentyl-1H-3,1-benzoxazin-2-one (PubChem CID 70402861) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4,4-dipentyl-1H-3,1-benzoxazin-2-one.
| Compound Name | 4,4-dipentyl-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 70402861 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4,4-dipentyl-1H-3,1-benzoxazin-2-one |
| SMILES | CCCCCC1(CCCCC)OC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H27NO2/c1-3-5-9-13-18(14-10-6-4-2)15-11-7-8-12-16(15)19-17(20)21-18/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3,(H,19,20) |
| InChIKey | WVVCKZHEOPSGBQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|