About 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one
6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one (PubChem CID 143713981) has the molecular formula C14H18FNO2
and a molecular weight of 251.30 g/mol. Its IUPAC name is 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one |
| PubChem CID | 143713981 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one |
| SMILES | CCCC1(CCC)OC(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C14H18FNO2/c1-3-7-14(8-4-2)11-9-10(15)5-6-12(11)16-13(17)18-14/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | VQDHQONTGYGMPY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one?
The IUPAC name of 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one (CID 143713981) is 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one.
What is the SMILES notation for 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one?
The canonical SMILES for 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one is CCCC1(CCC)OC(=O)Nc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one?
The InChIKey is VQDHQONTGYGMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2/c1-3-7-14(8-4-2)11-9-10(15)5-6-12(11)16-13(17)18-14/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17).
What are the key properties of 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one?
6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one has a molecular weight of 251.30 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4,4-dipropyl-1H-3,1-benzoxazin-2-one is sourced from PubChem (CID 143713981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).