C21H27N — CID 22754314
9,9-dibutyl-10H-acridine (PubChem CID 22754314) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 9,9-dibutyl-10H-acridine.
| Compound Name | 9,9-dibutyl-10H-acridine |
|---|---|
| PubChem CID | 22754314 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 9,9-dibutyl-10H-acridine |
| SMILES | CCCCC1(CCCC)c2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C21H27N/c1-3-5-15-21(16-6-4-2)17-11-7-9-13-19(17)22-20-14-10-8-12-18(20)21/h7-14,22H,3-6,15-16H2,1-2H3 |
| InChIKey | OFHBBDRLHHETNR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |