C20H27N — CID 155459617
9,9-dibutyl-3,4-dihydrocyclopenta[b]quinoline (PubChem CID 155459617) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 9,9-dibutyl-3,4-dihydrocyclopenta[b]quinoline.
| Compound Name | 9,9-dibutyl-3,4-dihydrocyclopenta[b]quinoline |
|---|---|
| PubChem CID | 155459617 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 9,9-dibutyl-3,4-dihydrocyclopenta[b]quinoline |
| SMILES | CCCCC1(CCCC)C2=C(CC=C2)Nc2ccccc21 |
| InChI | InChI=1S/C20H27N/c1-3-5-14-20(15-6-4-2)16-10-7-8-12-18(16)21-19-13-9-11-17(19)20/h7-12,21H,3-6,13-15H2,1-2H3 |
| InChIKey | BPSQLNYQTVSZNW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |