C15H24N2 — CID 162726892
2-(3-butyl-1,2-dihydroindol-3-yl)-N-methylethanamine (PubChem CID 162726892) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-(3-butyl-1,2-dihydroindol-3-yl)-N-methylethanamine.
| Compound Name | 2-(3-butyl-1,2-dihydroindol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 162726892 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-(3-butyl-1,2-dihydroindol-3-yl)-N-methylethanamine |
| SMILES | CCCCC1(CCNC)CNc2ccccc21 |
| InChI | InChI=1S/C15H24N2/c1-3-4-9-15(10-11-16-2)12-17-14-8-6-5-7-13(14)15/h5-8,16-17H,3-4,9-12H2,1-2H3 |
| InChIKey | ORTLSBARMOJAOU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |