About 3,3-dibutyl-2,4-dihydro-1H-quinoxaline
3,3-dibutyl-2,4-dihydro-1H-quinoxaline (PubChem CID 176936563) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 3,3-dibutyl-2,4-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 3,3-dibutyl-2,4-dihydro-1H-quinoxaline |
| PubChem CID | 176936563 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3,3-dibutyl-2,4-dihydro-1H-quinoxaline |
| SMILES | CCCCC1(CCCC)CNc2ccccc2N1 |
| InChI | InChI=1S/C16H26N2/c1-3-5-11-16(12-6-4-2)13-17-14-9-7-8-10-15(14)18-16/h7-10,17-18H,3-6,11-13H2,1-2H3 |
| InChIKey | OTIJXEGTRJHQCX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dibutyl-2,4-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibutyl-2,4-dihydro-1H-quinoxaline?
The IUPAC name of 3,3-dibutyl-2,4-dihydro-1H-quinoxaline (CID 176936563) is 3,3-dibutyl-2,4-dihydro-1H-quinoxaline.
What is the SMILES notation for 3,3-dibutyl-2,4-dihydro-1H-quinoxaline?
The canonical SMILES for 3,3-dibutyl-2,4-dihydro-1H-quinoxaline is CCCCC1(CCCC)CNc2ccccc2N1.
What is the InChIKey of 3,3-dibutyl-2,4-dihydro-1H-quinoxaline?
The InChIKey is OTIJXEGTRJHQCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-3-5-11-16(12-6-4-2)13-17-14-9-7-8-10-15(14)18-16/h7-10,17-18H,3-6,11-13H2,1-2H3.
What are the key properties of 3,3-dibutyl-2,4-dihydro-1H-quinoxaline?
3,3-dibutyl-2,4-dihydro-1H-quinoxaline has a molecular weight of 246.40 g/mol, XLogP of 4.64, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibutyl-2,4-dihydro-1H-quinoxaline is sourced from PubChem (CID 176936563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).