C14H20 — CID 101248337
[(1R,2S)-1-butyl-2-methylcyclopropyl]benzene (PubChem CID 101248337) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is [(1R,2S)-1-butyl-2-methylcyclopropyl]benzene.
| Compound Name | [(1R,2S)-1-butyl-2-methylcyclopropyl]benzene |
|---|---|
| PubChem CID | 101248337 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | [(1R,2S)-1-butyl-2-methylcyclopropyl]benzene |
| SMILES | CCCC[C@@]1(c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C14H20/c1-3-4-10-14(11-12(14)2)13-8-6-5-7-9-13/h5-9,12H,3-4,10-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | DKMHKIWATHLNME-GXTWGEPZSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |