C16H24O2 — CID 132539205
(2S,4R,6S)-4-butyl-2,6-dimethyl-4-phenyl-1,3-dioxane (PubChem CID 132539205) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2S,4R,6S)-4-butyl-2,6-dimethyl-4-phenyl-1,3-dioxane.
| Compound Name | (2S,4R,6S)-4-butyl-2,6-dimethyl-4-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 132539205 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2S,4R,6S)-4-butyl-2,6-dimethyl-4-phenyl-1,3-dioxane |
| SMILES | CCCC[C@]1(c2ccccc2)C[C@H](C)O[C@H](C)O1 |
| InChI | InChI=1S/C16H24O2/c1-4-5-11-16(15-9-7-6-8-10-15)12-13(2)17-14(3)18-16/h6-10,13-14H,4-5,11-12H2,1-3H3/t13-,14-,16+/m0/s1 |
| InChIKey | SKSNYRDRLTXOCD-OFQRWUPVSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |