C25H33NO2 — CID 10785977
(3aS,6aR)-5-octyl-2,2-diphenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 10785977) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (3aS,6aR)-5-octyl-2,2-diphenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,6aR)-5-octyl-2,2-diphenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 10785977 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (3aS,6aR)-5-octyl-2,2-diphenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CCCCCCCCN1C[C@@H]2OC(c3ccccc3)(c3ccccc3)O[C@@H]2C1 |
| InChI | InChI=1S/C25H33NO2/c1-2-3-4-5-6-13-18-26-19-23-24(20-26)28-25(27-23,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,23-24H,2-6,13,18-20H2,1H3/t23-,24+ |
| InChIKey | DKUUTPCGGHTKKU-PSWAGMNNSA-N |
| XLogP | 5.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|