C15H22O — CID 102318997
(S)-[(1S,2S)-2-butyl-2-methylcyclopropyl]-phenylmethanol (PubChem CID 102318997) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (S)-[(1S,2S)-2-butyl-2-methylcyclopropyl]-phenylmethanol.
| Compound Name | (S)-[(1S,2S)-2-butyl-2-methylcyclopropyl]-phenylmethanol |
|---|---|
| PubChem CID | 102318997 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (S)-[(1S,2S)-2-butyl-2-methylcyclopropyl]-phenylmethanol |
| SMILES | CCCC[C@@]1(C)C[C@@H]1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H22O/c1-3-4-10-15(2)11-13(15)14(16)12-8-6-5-7-9-12/h5-9,13-14,16H,3-4,10-11H2,1-2H3/t13-,14-,15+/m1/s1 |
| InChIKey | GFZOVKVHFFJKDV-KFWWJZLASA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |