C13H19NO — CID 162391375
(R)-[(2R)-5,5-dimethylpyrrolidin-2-yl]-phenylmethanol (PubChem CID 162391375) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (R)-[(2R)-5,5-dimethylpyrrolidin-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2R)-5,5-dimethylpyrrolidin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 162391375 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (R)-[(2R)-5,5-dimethylpyrrolidin-2-yl]-phenylmethanol |
| SMILES | CC1(C)CC[C@H]([C@H](O)c2ccccc2)N1 |
| InChI | InChI=1S/C13H19NO/c1-13(2)9-8-11(14-13)12(15)10-6-4-3-5-7-10/h3-7,11-12,14-15H,8-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | DAGTWUIYYQUJGV-VXGBXAGGSA-N |
| XLogP | 2.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |