C16H23NO3 — CID 155127057
[3-[[(2R)-6,6-dimethylpiperidin-2-yl]-hydroxymethyl]phenyl] acetate (PubChem CID 155127057) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [3-[[(2R)-6,6-dimethylpiperidin-2-yl]-hydroxymethyl]phenyl] acetate.
| Compound Name | [3-[[(2R)-6,6-dimethylpiperidin-2-yl]-hydroxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 155127057 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [3-[[(2R)-6,6-dimethylpiperidin-2-yl]-hydroxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(O)C2CCCC(C)(C)N2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-11(18)20-13-7-4-6-12(10-13)15(19)14-8-5-9-16(2,3)17-14/h4,6-7,10,14-15,17,19H,5,8-9H2,1-3H3 |
| InChIKey | XJRGUDFMEVDSQE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|