C17H25NO3 — CID 138473439
[3-[(R)-hydroxy-[(2R,6S)-6-propylpiperidin-2-yl]methyl]phenyl] acetate (PubChem CID 138473439) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [3-[(R)-hydroxy-[(2R,6S)-6-propylpiperidin-2-yl]methyl]phenyl] acetate.
| Compound Name | [3-[(R)-hydroxy-[(2R,6S)-6-propylpiperidin-2-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 138473439 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [3-[(R)-hydroxy-[(2R,6S)-6-propylpiperidin-2-yl]methyl]phenyl] acetate |
| SMILES | CCC[C@H]1CCC[C@H]([C@H](O)c2cccc(OC(C)=O)c2)N1 |
| InChI | InChI=1S/C17H25NO3/c1-3-6-14-8-5-10-16(18-14)17(20)13-7-4-9-15(11-13)21-12(2)19/h4,7,9,11,14,16-18,20H,3,5-6,8,10H2,1-2H3/t14-,16+,17+/m0/s1 |
| InChIKey | PTYPRYALMSMDMO-USXIJHARSA-N |
| XLogP | 2.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|