C21H27NO2 — CID 150322644
(S)-(3-phenylmethoxyphenyl)-[(2R,5R)-5-propylpyrrolidin-2-yl]methanol (PubChem CID 150322644) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (S)-(3-phenylmethoxyphenyl)-[(2R,5R)-5-propylpyrrolidin-2-yl]methanol.
| Compound Name | (S)-(3-phenylmethoxyphenyl)-[(2R,5R)-5-propylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 150322644 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (S)-(3-phenylmethoxyphenyl)-[(2R,5R)-5-propylpyrrolidin-2-yl]methanol |
| SMILES | CCC[C@@H]1CC[C@H]([C@@H](O)c2cccc(OCc3ccccc3)c2)N1 |
| InChI | InChI=1S/C21H27NO2/c1-2-7-18-12-13-20(22-18)21(23)17-10-6-11-19(14-17)24-15-16-8-4-3-5-9-16/h3-6,8-11,14,18,20-23H,2,7,12-13,15H2,1H3/t18-,20-,21+/m1/s1 |
| InChIKey | GNYRDJAHLIRAFP-NRSPTQNISA-N |
| XLogP | 4.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |