C15H23Cl2NO — CID 138473406
(3-chlorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride (PubChem CID 138473406) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is (3-chlorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride.
| Compound Name | (3-chlorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 138473406 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (3-chlorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride |
| SMILES | CCC[C@H]1CCC[C@H](C(O)c2cccc(Cl)c2)N1.Cl |
| InChI | InChI=1S/C15H22ClNO.ClH/c1-2-5-13-8-4-9-14(17-13)15(18)11-6-3-7-12(16)10-11;/h3,6-7,10,13-15,17-18H,2,4-5,8-9H2,1H3;1H/t13-,14+,15?;/m0./s1 |
| InChIKey | LSMGYFVRHNSVLS-IFAKAUOZSA-N |
| XLogP | 4.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |