About (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride
(4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride (PubChem CID 155074654) has the molecular formula C15H23ClFNO
and a molecular weight of 287.81 g/mol. Its IUPAC name is (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride |
| PubChem CID | 155074654 |
| Molecular Formula | C15H23ClFNO |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride |
| SMILES | CCC[C@H]1CCCC(C(O)c2ccc(F)cc2)N1.Cl |
| InChI | InChI=1S/C15H22FNO.ClH/c1-2-4-13-5-3-6-14(17-13)15(18)11-7-9-12(16)10-8-11;/h7-10,13-15,17-18H,2-6H2,1H3;1H/t13-,14?,15?;/m0./s1 |
| InChIKey | XFOSQZYZRDSNQF-PGXLAGJCSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride?
The IUPAC name of (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride (CID 155074654) is (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride.
What is the SMILES notation for (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride?
The canonical SMILES for (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride is CCC[C@H]1CCCC(C(O)c2ccc(F)cc2)N1.Cl.
What is the InChIKey of (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride?
The InChIKey is XFOSQZYZRDSNQF-PGXLAGJCSA-N. The full InChI is InChI=1S/C15H22FNO.ClH/c1-2-4-13-5-3-6-14(17-13)15(18)11-7-9-12(16)10-8-11;/h7-10,13-15,17-18H,2-6H2,1H3;1H/t13-,14?,15?;/m0./s1.
What are the key properties of (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride?
(4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride has a molecular weight of 287.81 g/mol, XLogP of 3.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)-[(2R,6S)-6-propylpiperidin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 155074654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).