C14H19Cl2NO — CID 70515421
(3,4-dichlorophenyl)-(6,6-dimethylpiperidin-2-yl)methanol (PubChem CID 70515421) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(6,6-dimethylpiperidin-2-yl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(6,6-dimethylpiperidin-2-yl)methanol |
|---|---|
| PubChem CID | 70515421 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (3,4-dichlorophenyl)-(6,6-dimethylpiperidin-2-yl)methanol |
| SMILES | CC1(C)CCCC(C(O)c2ccc(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-14(2)7-3-4-12(17-14)13(18)9-5-6-10(15)11(16)8-9/h5-6,8,12-13,17-18H,3-4,7H2,1-2H3 |
| InChIKey | MCZOYWTZELRBJA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |