C14H20FNO — CID 155126963
[(2S)-6,6-dimethylpiperidin-2-yl]-(2-fluorophenyl)methanol (PubChem CID 155126963) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is [(2S)-6,6-dimethylpiperidin-2-yl]-(2-fluorophenyl)methanol.
| Compound Name | [(2S)-6,6-dimethylpiperidin-2-yl]-(2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 155126963 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [(2S)-6,6-dimethylpiperidin-2-yl]-(2-fluorophenyl)methanol |
| SMILES | CC1(C)CCC[C@@H](C(O)c2ccccc2F)N1 |
| InChI | InChI=1S/C14H20FNO/c1-14(2)9-5-8-12(16-14)13(17)10-6-3-4-7-11(10)15/h3-4,6-7,12-13,16-17H,5,8-9H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | HIBPADUTUROJGI-UEWDXFNNSA-N |
| XLogP | 2.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |