About (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol
(S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol (PubChem CID 155127118) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol.
Molecular Properties
| Compound Name | (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol |
| PubChem CID | 155127118 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol |
| SMILES | CC1(C)CCC([C@@H](O)c2ccccc2F)N1 |
| InChI | InChI=1S/C13H18FNO/c1-13(2)8-7-11(15-13)12(16)9-5-3-4-6-10(9)14/h3-6,11-12,15-16H,7-8H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | LXVWAGLYKRPOQV-KIYNQFGBSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol?
The IUPAC name of (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol (CID 155127118) is (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol.
What is the SMILES notation for (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol?
The canonical SMILES for (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol is CC1(C)CCC([C@@H](O)c2ccccc2F)N1.
What is the InChIKey of (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol?
The InChIKey is LXVWAGLYKRPOQV-KIYNQFGBSA-N. The full InChI is InChI=1S/C13H18FNO/c1-13(2)8-7-11(15-13)12(16)9-5-3-4-6-10(9)14/h3-6,11-12,15-16H,7-8H2,1-2H3/t11?,12-/m0/s1.
What are the key properties of (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol?
(S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol has a molecular weight of 223.29 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(5,5-dimethylpyrrolidin-2-yl)-(2-fluorophenyl)methanol is sourced from PubChem (CID 155127118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).