About (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol
(1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol (PubChem CID 155010711) has the molecular formula C21H29NOS
and a molecular weight of 343.54 g/mol. Its IUPAC name is (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol |
| PubChem CID | 155010711 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol |
| SMILES | CC1(C)CC[C@@H]([C@H](O)CS(C)(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C21H29NOS/c1-21(2)15-14-19(22-21)20(23)16-24(3,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19-20,22-23H,14-16H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | YOFUZVIGMHVOPG-VQTJNVASSA-N |
| XLogP | 4.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol?
The IUPAC name of (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol (CID 155010711) is (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol.
What is the SMILES notation for (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol?
The canonical SMILES for (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol is CC1(C)CC[C@@H]([C@H](O)CS(C)(c2ccccc2)c2ccccc2)N1.
What is the InChIKey of (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol?
The InChIKey is YOFUZVIGMHVOPG-VQTJNVASSA-N. The full InChI is InChI=1S/C21H29NOS/c1-21(2)15-14-19(22-21)20(23)16-24(3,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19-20,22-23H,14-16H2,1-3H3/t19-,20+/m0/s1.
What are the key properties of (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol?
(1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol has a molecular weight of 343.54 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2S)-5,5-dimethylpyrrolidin-2-yl]-2-[methyl(diphenyl)-λ4-sulfanyl]ethanol is sourced from PubChem (CID 155010711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).