C16H25F2NOS — CID 64820151
6-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)hexan-1-ol (PubChem CID 64820151) has the molecular formula C16H25F2NOS and a molecular weight of 317.44 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)hexan-1-ol.
| Compound Name | 6-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)hexan-1-ol |
|---|---|
| PubChem CID | 64820151 |
| Molecular Formula | C16H25F2NOS |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 6-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)hexan-1-ol |
| SMILES | CC(C)NC(C)(CO)CCCCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H25F2NOS/c1-12(2)19-16(3,11-20)8-4-5-9-21-13-6-7-14(17)15(18)10-13/h6-7,10,12,19-20H,4-5,8-9,11H2,1-3H3 |
| InChIKey | GQAHKVFDMALWJI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|