About (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate
(2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate (PubChem CID 129168523) has the molecular formula C14H15IO4
and a molecular weight of 374.17 g/mol. Its IUPAC name is (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate |
| PubChem CID | 129168523 |
| Molecular Formula | C14H15IO4 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1CC(=O)Oc2ccccc21 |
| InChI | InChI=1S/C14H15IO4/c1-3-14(2,15)13(17)19-11-8-12(16)18-10-7-5-4-6-9(10)11/h4-7,11H,3,8H2,1-2H3 |
| InChIKey | GKXDNMBAZLSPOL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate?
The IUPAC name of (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate (CID 129168523) is (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate.
What is the SMILES notation for (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate?
The canonical SMILES for (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)OC1CC(=O)Oc2ccccc21.
What is the InChIKey of (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate?
The InChIKey is GKXDNMBAZLSPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15IO4/c1-3-14(2,15)13(17)19-11-8-12(16)18-10-7-5-4-6-9(10)11/h4-7,11H,3,8H2,1-2H3.
What are the key properties of (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate?
(2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate has a molecular weight of 374.17 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3,4-dihydrochromen-4-yl) 2-iodo-2-methylbutanoate is sourced from PubChem (CID 129168523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).