C12H16O3 — CID 101362429
(2S,4S)-2,4-dimethoxy-2-methyl-3,4-dihydrochromene (PubChem CID 101362429) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethoxy-2-methyl-3,4-dihydrochromene.
| Compound Name | (2S,4S)-2,4-dimethoxy-2-methyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 101362429 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2S,4S)-2,4-dimethoxy-2-methyl-3,4-dihydrochromene |
| SMILES | CO[C@H]1C[C@@](C)(OC)Oc2ccccc21 |
| InChI | InChI=1S/C12H16O3/c1-12(14-3)8-11(13-2)9-6-4-5-7-10(9)15-12/h4-7,11H,8H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | LUWNTDCNQODLNL-RYUDHWBXSA-N |
| XLogP | 2.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |