C15H22O3 — CID 10729365
2,4-dimethoxy-2-methyl-6-propan-2-yl-3,4-dihydrochromene (PubChem CID 10729365) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,4-dimethoxy-2-methyl-6-propan-2-yl-3,4-dihydrochromene.
| Compound Name | 2,4-dimethoxy-2-methyl-6-propan-2-yl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 10729365 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2,4-dimethoxy-2-methyl-6-propan-2-yl-3,4-dihydrochromene |
| SMILES | COC1CC(C)(OC)Oc2ccc(C(C)C)cc21 |
| InChI | InChI=1S/C15H22O3/c1-10(2)11-6-7-13-12(8-11)14(16-4)9-15(3,17-5)18-13/h6-8,10,14H,9H2,1-5H3 |
| InChIKey | HXYWJZCIKSCCRY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |