C17H16O2 — CID 102139812
(3S,4R)-3,4-diphenyloxan-2-one (PubChem CID 102139812) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3S,4R)-3,4-diphenyloxan-2-one.
| Compound Name | (3S,4R)-3,4-diphenyloxan-2-one |
|---|---|
| PubChem CID | 102139812 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (3S,4R)-3,4-diphenyloxan-2-one |
| SMILES | O=C1OCC[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16O2/c18-17-16(14-9-5-2-6-10-14)15(11-12-19-17)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+/m0/s1 |
| InChIKey | KLAKGBROIMGXKR-JKSUJKDBSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |