C20H16O2 — CID 122222249
(3S,4S)-3-naphthalen-2-yl-4-phenyloxolan-2-one (PubChem CID 122222249) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (3S,4S)-3-naphthalen-2-yl-4-phenyloxolan-2-one.
| Compound Name | (3S,4S)-3-naphthalen-2-yl-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 122222249 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3S,4S)-3-naphthalen-2-yl-4-phenyloxolan-2-one |
| SMILES | O=C1OC[C@H](c2ccccc2)[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16O2/c21-20-19(18(13-22-20)15-7-2-1-3-8-15)17-11-10-14-6-4-5-9-16(14)12-17/h1-12,18-19H,13H2/t18-,19-/m1/s1 |
| InChIKey | INHNCZQQGAZXDW-RTBURBONSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |