C22H19F3O2 — CID 139042590
(2R,4R,5R)-5-naphthalen-2-yl-4-phenyl-2-(trifluoromethyl)oxan-2-ol (PubChem CID 139042590) has the molecular formula C22H19F3O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is (2R,4R,5R)-5-naphthalen-2-yl-4-phenyl-2-(trifluoromethyl)oxan-2-ol.
| Compound Name | (2R,4R,5R)-5-naphthalen-2-yl-4-phenyl-2-(trifluoromethyl)oxan-2-ol |
|---|---|
| PubChem CID | 139042590 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (2R,4R,5R)-5-naphthalen-2-yl-4-phenyl-2-(trifluoromethyl)oxan-2-ol |
| SMILES | O[C@]1(C(F)(F)F)C[C@@H](c2ccccc2)[C@H](c2ccc3ccccc3c2)CO1 |
| InChI | InChI=1S/C22H19F3O2/c23-22(24,25)21(26)13-19(16-7-2-1-3-8-16)20(14-27-21)18-11-10-15-6-4-5-9-17(15)12-18/h1-12,19-20,26H,13-14H2/t19-,20-,21+/m0/s1 |
| InChIKey | DWRZFVAEFCUZTE-PCCBWWKXSA-N |
| XLogP | 5.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |