C24H22F6O — CID 155808982
(3R,5S)-3-[3,5-bis(trifluoromethyl)phenyl]-5-naphthalen-2-ylhexan-1-ol (PubChem CID 155808982) has the molecular formula C24H22F6O and a molecular weight of 440.43 g/mol. Its IUPAC name is (3R,5S)-3-[3,5-bis(trifluoromethyl)phenyl]-5-naphthalen-2-ylhexan-1-ol.
| Compound Name | (3R,5S)-3-[3,5-bis(trifluoromethyl)phenyl]-5-naphthalen-2-ylhexan-1-ol |
|---|---|
| PubChem CID | 155808982 |
| Molecular Formula | C24H22F6O |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (3R,5S)-3-[3,5-bis(trifluoromethyl)phenyl]-5-naphthalen-2-ylhexan-1-ol |
| SMILES | C[C@@H](C[C@H](CCO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H22F6O/c1-15(17-7-6-16-4-2-3-5-18(16)11-17)10-19(8-9-31)20-12-21(23(25,26)27)14-22(13-20)24(28,29)30/h2-7,11-15,19,31H,8-10H2,1H3/t15-,19-/m0/s1 |
| InChIKey | SWIYAVINRILCHY-KXBFYZLASA-N |
| XLogP | 7.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |