C20H30O8 — CID 101361506
(1R,7Z,15R,17R,18R)-17,18-dimethoxy-17,18-dimethyl-9-methylidene-3,13,16,19-tetraoxabicyclo[13.4.0]nonadec-7-ene-2,14-dione (PubChem CID 101361506) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is (1R,7Z,15R,17R,18R)-17,18-dimethoxy-17,18-dimethyl-9-methylidene-3,13,16,19-tetraoxabicyclo[13.4.0]nonadec-7-ene-2,14-dione.
| Compound Name | (1R,7Z,15R,17R,18R)-17,18-dimethoxy-17,18-dimethyl-9-methylidene-3,13,16,19-tetraoxabicyclo[13.4.0]nonadec-7-ene-2,14-dione |
|---|---|
| PubChem CID | 101361506 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (1R,7Z,15R,17R,18R)-17,18-dimethoxy-17,18-dimethyl-9-methylidene-3,13,16,19-tetraoxabicyclo[13.4.0]nonadec-7-ene-2,14-dione |
| SMILES | C=C1/C=C\CCCOC(=O)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2C(=O)OCCC1 |
| InChI | InChI=1S/C20H30O8/c1-14-10-7-6-8-12-25-17(21)15-16(18(22)26-13-9-11-14)28-20(3,24-5)19(2,23-4)27-15/h7,10,15-16H,1,6,8-9,11-13H2,2-5H3/b10-7-/t15-,16-,19-,20-/m1/s1 |
| InChIKey | ZZYQKWPEKKUMHH-BFNVFEASSA-N |
| XLogP | 2.27 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |