C17H24O8 — CID 135061041
(5Z)-5-ethenyl-13,14-dimethoxy-13,14-dimethyl-3,9,12,15-tetraoxabicyclo[9.4.0]pentadec-5-ene-2,10-dione (PubChem CID 135061041) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is (5Z)-5-ethenyl-13,14-dimethoxy-13,14-dimethyl-3,9,12,15-tetraoxabicyclo[9.4.0]pentadec-5-ene-2,10-dione.
| Compound Name | (5Z)-5-ethenyl-13,14-dimethoxy-13,14-dimethyl-3,9,12,15-tetraoxabicyclo[9.4.0]pentadec-5-ene-2,10-dione |
|---|---|
| PubChem CID | 135061041 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (5Z)-5-ethenyl-13,14-dimethoxy-13,14-dimethyl-3,9,12,15-tetraoxabicyclo[9.4.0]pentadec-5-ene-2,10-dione |
| SMILES | C=C/C1=C/CCOC(=O)C2OC(C)(OC)C(C)(OC)OC2C(=O)OC1 |
| InChI | InChI=1S/C17H24O8/c1-6-11-8-7-9-22-14(18)12-13(15(19)23-10-11)25-17(3,21-5)16(2,20-4)24-12/h6,8,12-13H,1,7,9-10H2,2-5H3/b11-8- |
| InChIKey | QEQLRUVMAYIAIE-FLIBITNWSA-N |
| XLogP | 1.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |