C22H34O8 — CID 135060834
2-O-(4-methylidenehex-5-enyl) 3-O-pent-4-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate (PubChem CID 135060834) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-O-(4-methylidenehex-5-enyl) 3-O-pent-4-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate.
| Compound Name | 2-O-(4-methylidenehex-5-enyl) 3-O-pent-4-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135060834 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-O-(4-methylidenehex-5-enyl) 3-O-pent-4-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate |
| SMILES | C=CCCCOC(=O)C1OC(C)(OC)C(C)(OC)OC1C(=O)OCCCC(=C)C=C |
| InChI | InChI=1S/C22H34O8/c1-8-10-11-14-27-19(23)17-18(20(24)28-15-12-13-16(3)9-2)30-22(5,26-7)21(4,25-6)29-17/h8-9,17-18H,1-3,10-15H2,4-7H3 |
| InChIKey | MVONWVHNWKOMAN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|