C17H17BrO3 — CID 11100162
(1S,3R,6R,7S,10S)-8-bromo-3-methoxy-1-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 11100162) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is (1S,3R,6R,7S,10S)-8-bromo-3-methoxy-1-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1S,3R,6R,7S,10S)-8-bromo-3-methoxy-1-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 11100162 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (1S,3R,6R,7S,10S)-8-bromo-3-methoxy-1-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | CO[C@@]12OC[C@@H]3[C@@H](c4ccccc4)[C@@](C)(C=C(Br)[C@@H]31)C2=O |
| InChI | InChI=1S/C17H17BrO3/c1-16-8-12(18)14-11(9-21-17(14,20-2)15(16)19)13(16)10-6-4-3-5-7-10/h3-8,11,13-14H,9H2,1-2H3/t11-,13-,14-,16-,17-/m1/s1 |
| InChIKey | UUFHZGUVVBDIID-TXNBRISYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |