C12H12O — CID 91147998
[(1R,2S,3S)-2-ethynyl-3-methoxycyclopropyl]benzene (PubChem CID 91147998) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is [(1R,2S,3S)-2-ethynyl-3-methoxycyclopropyl]benzene.
| Compound Name | [(1R,2S,3S)-2-ethynyl-3-methoxycyclopropyl]benzene |
|---|---|
| PubChem CID | 91147998 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | [(1R,2S,3S)-2-ethynyl-3-methoxycyclopropyl]benzene |
| SMILES | C#C[C@H]1[C@H](OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H12O/c1-3-10-11(12(10)13-2)9-7-5-4-6-8-9/h1,4-8,10-12H,2H3/t10-,11+,12+/m1/s1 |
| InChIKey | YBSMZSDXVIHFRE-WOPDTQHZSA-N |
| XLogP | 2.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|