C16H18O5 — CID 101224240
(4aR,6S,7S,8R,8aS)-7-ethynyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 101224240) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is (4aR,6S,7S,8R,8aS)-7-ethynyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6S,7S,8R,8aS)-7-ethynyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 101224240 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (4aR,6S,7S,8R,8aS)-7-ethynyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | C#C[C@@H]1[C@@H](OC)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C16H18O5/c1-3-11-13(17)14-12(20-16(11)18-2)9-19-15(21-14)10-7-5-4-6-8-10/h1,4-8,11-17H,9H2,2H3/t11-,12+,13+,14+,15?,16-/m0/s1 |
| InChIKey | MRKLXRJMIKHZPI-FXTQWZAVSA-N |
| XLogP | 1.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|