C20H17Cl5O5 — CID 101102124
(2R,4aR,6S,7S,8S,8aS)-6-methoxy-7-(2,3,4,5,6-pentachlorophenyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 101102124) has the molecular formula C20H17Cl5O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8S,8aS)-6-methoxy-7-(2,3,4,5,6-pentachlorophenyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2R,4aR,6S,7S,8S,8aS)-6-methoxy-7-(2,3,4,5,6-pentachlorophenyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 101102124 |
| Molecular Formula | C20H17Cl5O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | (2R,4aR,6S,7S,8S,8aS)-6-methoxy-7-(2,3,4,5,6-pentachlorophenyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H](O)[C@@H]1c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C20H17Cl5O5/c1-27-20-11(10-12(21)14(23)16(25)15(24)13(10)22)17(26)18-9(29-20)7-28-19(30-18)8-5-3-2-4-6-8/h2-6,9,11,17-20,26H,7H2,1H3/t9-,11+,17+,18-,19-,20+/m1/s1 |
| InChIKey | MJMOUYFUXOEOGI-LELDTZASSA-N |
| XLogP | 5.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|