C10H8O — CID 11768694
(2S,3S)-2-ethynyl-3-phenyloxirane (PubChem CID 11768694) has the molecular formula C10H8O and a molecular weight of 144.17 g/mol. Its IUPAC name is (2S,3S)-2-ethynyl-3-phenyloxirane.
| Compound Name | (2S,3S)-2-ethynyl-3-phenyloxirane |
|---|---|
| PubChem CID | 11768694 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (2S,3S)-2-ethynyl-3-phenyloxirane |
| SMILES | C#C[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H8O/c1-2-9-10(11-9)8-6-4-3-5-7-8/h1,3-7,9-10H/t9-,10-/m0/s1 |
| InChIKey | VQMLIYNSAGLXAT-UWVGGRQHSA-N |
| XLogP | 1.76 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|