C14H16O8 — CID 101243540
tetramethyl cyclohexa-2,5-diene-1,2,3,4-tetracarboxylate (PubChem CID 101243540) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is tetramethyl cyclohexa-2,5-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl cyclohexa-2,5-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 101243540 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | tetramethyl cyclohexa-2,5-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)C=CC1C(=O)OC |
| InChI | InChI=1S/C14H16O8/c1-19-11(15)7-5-6-8(12(16)20-2)10(14(18)22-4)9(7)13(17)21-3/h5-8H,1-4H3 |
| InChIKey | OWIMSWOQQWOXTA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|