C22H28O4 — CID 10021186
dimethyl (1R,4R)-2,3-di(cyclohexen-1-yl)cyclohexa-2,5-diene-1,4-dicarboxylate (PubChem CID 10021186) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is dimethyl (1R,4R)-2,3-di(cyclohexen-1-yl)cyclohexa-2,5-diene-1,4-dicarboxylate.
| Compound Name | dimethyl (1R,4R)-2,3-di(cyclohexen-1-yl)cyclohexa-2,5-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10021186 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | dimethyl (1R,4R)-2,3-di(cyclohexen-1-yl)cyclohexa-2,5-diene-1,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C=C[C@@H](C(=O)OC)C(C2=CCCCC2)=C1C1=CCCCC1 |
| InChI | InChI=1S/C22H28O4/c1-25-21(23)17-13-14-18(22(24)26-2)20(16-11-7-4-8-12-16)19(17)15-9-5-3-6-10-15/h9,11,13-14,17-18H,3-8,10,12H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | XIHHCQUCBVEEBM-QZTJIDSGSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|