C13H16CrO2 — CID 11058365
[[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium (PubChem CID 11058365) has the molecular formula C13H16CrO2 and a molecular weight of 256.26 g/mol. Its IUPAC name is [[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium.
| Compound Name | [[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium |
|---|---|
| PubChem CID | 11058365 |
| Molecular Formula | C13H16CrO2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [[6-(cyclopenten-1-yl)-2-oxabicyclo[3.2.0]hept-6-en-7-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C2=CCCC2)C2CCOC12 |
| InChI | InChI=1S/C13H16O2.Cr/c1-14-8-11-12(9-4-2-3-5-9)10-6-7-15-13(10)11;/h4,10,13H,2-3,5-7H2,1H3; |
| InChIKey | GGGWTZLNEUYXBK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |