About methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate
methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate (PubChem CID 12670722) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate.
Analyze methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate?
The IUPAC name of methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate (CID 12670722) is methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate.
What is the SMILES notation for methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate?
The canonical SMILES for methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate is COC(=O)C1C=CC=C(C)C=C1C.
What is the InChIKey of methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate?
The InChIKey is KEOKCVDNYJLEIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-8-5-4-6-10(9(2)7-8)11(12)13-3/h4-7,10H,1-3H3.
What are the key properties of methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate?
methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate has a molecular weight of 178.23 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethylcyclohepta-2,4,6-triene-1-carboxylate is sourced from PubChem (CID 12670722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).