C11H13NO6S — CID 140969946
methyl 5-[methoxycarbonyl(methyl)amino]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 140969946) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is methyl 5-[methoxycarbonyl(methyl)amino]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 5-[methoxycarbonyl(methyl)amino]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 140969946 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | methyl 5-[methoxycarbonyl(methyl)amino]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1C=CC=C(N(C)C(=O)OC)C1=S(=O)=O |
| InChI | InChI=1S/C11H13NO6S/c1-12(11(14)18-3)8-6-4-5-7(10(13)17-2)9(8)19(15)16/h4-7H,1-3H3 |
| InChIKey | LQTXPUGTNWJYNE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|