C9H11FO4 — CID 135226188
dimethyl (1R)-4-fluorocyclopent-2-ene-1,2-dicarboxylate (PubChem CID 135226188) has the molecular formula C9H11FO4 and a molecular weight of 202.18 g/mol. Its IUPAC name is dimethyl (1R)-4-fluorocyclopent-2-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R)-4-fluorocyclopent-2-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135226188 |
| Molecular Formula | C9H11FO4 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | dimethyl (1R)-4-fluorocyclopent-2-ene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=CC(F)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C9H11FO4/c1-13-8(11)6-3-5(10)4-7(6)9(12)14-2/h3,5,7H,4H2,1-2H3/t5?,7-/m1/s1 |
| InChIKey | VRYVEJGHGNDPSM-NQPNHJOESA-N |
| XLogP | 0.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |