C11H15NO6 — CID 11128953
trimethyl (2S,4R)-1,2,3,4-tetrahydropyridine-2,4,5-tricarboxylate (PubChem CID 11128953) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is trimethyl (2S,4R)-1,2,3,4-tetrahydropyridine-2,4,5-tricarboxylate.
| Compound Name | trimethyl (2S,4R)-1,2,3,4-tetrahydropyridine-2,4,5-tricarboxylate |
|---|---|
| PubChem CID | 11128953 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | trimethyl (2S,4R)-1,2,3,4-tetrahydropyridine-2,4,5-tricarboxylate |
| SMILES | COC(=O)C1=CN[C@H](C(=O)OC)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C11H15NO6/c1-16-9(13)6-4-8(11(15)18-3)12-5-7(6)10(14)17-2/h5-6,8,12H,4H2,1-3H3/t6-,8+/m1/s1 |
| InChIKey | MQPOYRDIUDBUFX-SVRRBLITSA-N |
| XLogP | -0.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|