About methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate
methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate (PubChem CID 156837427) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate.
Analyze methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate?
The IUPAC name of methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate (CID 156837427) is methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate.
What is the SMILES notation for methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate?
The canonical SMILES for methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate is CO.COC(=O)C1CC(C)=CN1.
What is the InChIKey of methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate?
The InChIKey is VTPDEXTXICFQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.CH4O/c1-5-3-6(8-4-5)7(9)10-2;1-2/h4,6,8H,3H2,1-2H3;2H,1H3.
What are the key properties of methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate?
methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate has a molecular weight of 173.21 g/mol, XLogP of 0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl 4-methyl-2,3-dihydro-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 156837427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).