C8H11IO3 — CID 118018354
methyl (4S,6S)-6-hydroxy-4-iodocyclohexene-1-carboxylate (PubChem CID 118018354) has the molecular formula C8H11IO3 and a molecular weight of 282.08 g/mol. Its IUPAC name is methyl (4S,6S)-6-hydroxy-4-iodocyclohexene-1-carboxylate.
| Compound Name | methyl (4S,6S)-6-hydroxy-4-iodocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 118018354 |
| Molecular Formula | C8H11IO3 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | methyl (4S,6S)-6-hydroxy-4-iodocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@H](I)C[C@@H]1O |
| InChI | InChI=1S/C8H11IO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h3,5,7,10H,2,4H2,1H3/t5-,7-/m0/s1 |
| InChIKey | LSFVWNHEFXQTNH-FSPLSTOPSA-N |
| XLogP | 1.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|