About methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate
methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 130281891) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate.
Analyze methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate (CID 130281891) is methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC(O)=CC[C@H]1O.
What is the InChIKey of methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
The InChIKey is ODYMLMBRPIZOPV-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H10O4/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2,4,7,9-10H,3H2,1H3/t7-/m1/s1.
What are the key properties of methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate has a molecular weight of 170.16 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6R)-3,6-dihydroxycyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 130281891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).