C9H10O4 — CID 10583569
methyl 3,9-dioxatricyclo[6.1.0.02,4]non-5-ene-5-carboxylate (PubChem CID 10583569) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is methyl 3,9-dioxatricyclo[6.1.0.02,4]non-5-ene-5-carboxylate.
| Compound Name | methyl 3,9-dioxatricyclo[6.1.0.02,4]non-5-ene-5-carboxylate |
|---|---|
| PubChem CID | 10583569 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | methyl 3,9-dioxatricyclo[6.1.0.02,4]non-5-ene-5-carboxylate |
| SMILES | COC(=O)C1=CCC2OC2C2OC12 |
| InChI | InChI=1S/C9H10O4/c1-11-9(10)4-2-3-5-7(12-5)8-6(4)13-8/h2,5-8H,3H2,1H3 |
| InChIKey | SWLIMINIBGBBEC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|